• Search chemicals, activators, Inhibitors, APIs, intermediates and raw materials.

B 261

(CAS: 127070-69-3)

Suppliers of B 261

Company Name Email Tel Country
Ark Pharm, Inc. [email protected] +1 (847) 367-3680 USA

Fax: +1 (847) 367-3681Purity: Brand:

Shanghai Haoyuan Chemexpress Co., Ltd. [email protected] +86 (21) 5187-0955 / +86 (21) 5895-5995 China

Fax: +86 (21) 5895-5996Purity: Brand:

Inquiry Online

Salutation: *Country:
*Customer: *Company Name:
*Email: *Request quantity:
Remarks:
 

Notice: Your contact information will be sent to selected suppliers.

* Required Fields.

Background Information of B 261

Solubility of B 261

Solubility Sources

Storage Condition of B 261

Storage Condition Sources

MSDS Information

MSDS Sources

Quality Control and Spectral Data

QC Reports Sources

Mechanism and Indications

Signaling Pathways
Target
Research Area
Indications

Clinical Information

Product Name Sponsor & Collaborators Indications Start Date End Date Phase
B 261 - No Development Reported

Chemical Information

M.Wt Formula CAS No. Synonyms
567.7 C24H29N3O7S3 127070-69-3 B261;B-261;8-Ethoxy-N,N,N',N',N'',N''-hexamethylpyrene-1,3,6-trisulfonamid; 8-ethoxy-N1,N1,N3,N3,N6,N6-hexamethylpyrene-1,3,6-trisulfonamide

Structure Information of B 261

Smiles O=S(C1=C(C2=C34)C=CC4=C(OCC)C=C(S(=O)(N(C)C)=O)C3=CC=C2C(S(=O)(N(C)C)=O)=C1)(N(C)C)=O
InChI InChI=1S/C24H29N3O7S3/c1-8-34-19-13-20(35(28,29)25(2)3)16-11-12-18-22(37(32,33)27(6)7)14-21(36(30,31)26(4)5)17-10-9-15(19)23(16)24(17)18/h9-14H,8H2,1-7H3

Related Products

Other Form Products of B 261

Name CAS Formula Suppliers

Recommended Products in Same Target

Name CAS Formula Suppliers

Recommended Products in the Same Indication

Name CAS Formula Suppliers

Chemical and Physical Properties

Appearance: Melting point:
Boiling point: Flash Point:
Water Solubility: Solubility:
Density: Merck:
BRN: Refractive Index:
Vapour: EINECS:
Optical Rotation: alpha:

Reference

Tags: buy B 261 | B 261 IC50 | B 261 price | B 261 cost | B 261 solubility | B 261 purchase | B 261 manufacturer | B 261 research buy | B 261 order | B 261 MSDS | B 261 chemical structure | B 261 Storage condition | B 261 molecular weight | B 261 mw | B 261 datasheet | B 261 supplier | B 261 cell line | B 261 NMR | B 261 MS | B 261 IR | B 261 solubility | B 261 Safe information | B 261 Qc and Spectral Information | B 261 Clinical Information | B 261 Clinical Trial | B 261 Route of Synthesis | B 261 storage condition | B 261 diseases and conditions | B 261 flash point | B 261 boiling point | B 261 melting point | B 261 storage condition | B 261 brand