• Search chemicals, activators, Inhibitors, APIs, intermediates and raw materials.

GBR 12935 (dihydrochloride)

(CAS: 67469-81-2)

Suppliers of GBR 12935 (dihydrochloride)

Company Name Email Tel Country
BOC Sciences [email protected] 1-631-504-6093

Fax: 1-631-614-7828Purity: 0.99 Brand: BOC Sciences

Biochempartner Co., Ltd [email protected] 0086-13720134139; 0086-15971444841 China

Fax: Purity: 98% Brand: Biochempartner

CHEMSCENE, LLC [email protected] 732-484-9848 USA

Fax: 888-484-5008Purity: Brand:

Price and Availability: USD60/10mg () USD120/50mg ()

Cayman Chemical Company [email protected] Toll Free (USA and Canada Only): (800) 364-9897; Direct: (734) 971-3335;Technical Support Toll Free (USA and Canada Only): (888) 526-5351;Technical Support Direct: (734) 975-3888 USA

Fax: (734) 971-3640Purity: Brand:

Price and Availability: USD55/10mg ()

Clearsynth Labs Limited [email protected] Worldwide Helpline No. +1-415-685-4395; US & Canada (Toll-free) : +1-800-650-8239; Europe : +44-20-3286-0885; India : +91-22-26355700 India

Fax: Purity: Brand:

Price and Availability: USD100/25mg ()

MedChemexpress Co., Ltd. [email protected] 609-228-6898 USA

Fax: 609-228-5909Purity: Brand:

Price and Availability: USD60/10mg () USD120/50mg ()
Quality Control & MSDS Files: LCMS HNMR MSDS

MedKoo Biosciences, Inc. [email protected] 919-279-0682 USA

Fax: 919-980-4831Purity: Brand:

Price and Availability: USD50/5mg ()

Santa Cruz Biotechnology, Inc. [email protected] Toll Free: 800-457-3801 Phone: 214-902-3900 USA

Fax: 214-358-6070Purity: Brand:

Price and Availability: USD65/10mg ()

Shanghai Haoyuan Chemexpress Co., Ltd. [email protected] +86 (21) 5187-0955 / +86 (21) 5895-5995 China

Fax: +86 (21) 5895-5996Purity: Brand:

Price and Availability: USD60/10mg () USD120/50mg ()

Sigma-Aldrich, Inc. [email protected] +86 (21) 6141-5566 / 800-819-3336 USA

Fax: Purity: Brand:

Price and Availability: USD142/25mg ()

Target Molecule Corp. [email protected] (857) 239-0968 USA

Fax: 857-239-8801Purity: .98 Brand: TargetMol

Price and Availability: USD68/10mg () USD112/25mg () USD178/50mg () USD325/100mg ()

Tocris Bioscience Inc. [email protected]; [email protected] +1 (636) 207-7651 USA

Fax: +1 (636) 207-7683Purity: Brand:

Price and Availability: USD69/10mg ()

Inquiry Online

Salutation: *Country:
*Customer: *Company Name:
*Email: *Request quantity:
Remarks:
 

Notice: Your contact information will be sent to selected suppliers.

* Required Fields.

Background Information of GBR 12935 (dihydrochloride)

GBR 12935 2Hcl is a potent, and selective dopamine reuptake inhibitor. IC50 value: Target: dopamine reuptake inhibitor in vitro: The calculated Kd of [3H]GBR-12935 binding to CYP2D6 was 42.2 nM, indicating that GBR-12935 has a high affinity for CYP2D6.

Solubility of GBR 12935 (dihydrochloride)

Solubility Sources

Storage Condition of GBR 12935 (dihydrochloride)

Storage Condition Sources

MSDS Information

MSDS Sources
MedChemexpress Co., Ltd.

Quality Control and Spectral Data

QC Reports Sources
[LCMS] [HNMR] MedChemexpress Co., Ltd.

Mechanism and Indications

Signaling Pathways Neuronal Signaling
Target Dopamine Transporter
Research Area Neurological Disease
Indications

Clinical Information

Product Name Sponsor & Collaborators Indications Start Date End Date Phase
GBR 12935 (dihydrochloride) - Not Found
GBR 12935 (dihydrochloride) - No Development Reported

Chemical Information

M.Wt Formula CAS No. Synonyms
487.5 C28H36Cl2N2O 67469-81-2 GBR12935 dihydrochloride;GBR-12935 dihydrochloride; 1-(2-(benzhydryloxy)ethyl)-4-(3-phenylpropyl)piperazine dihydrochloride

Structure Information of GBR 12935 (dihydrochloride)

Smiles N1(CCOC(C2=CC=CC=C2)C3=CC=CC=C3)CCN(CCCC4=CC=CC=C4)CC1.Cl.Cl
InChI InChI=1S/C28H34N2O.2ClH/c1-4-11-25(12-5-1)13-10-18-29-19-21-30(22-20-29)23-24-31-28(26-14-6-2-7-15-26)27-16-8-3-9-17-27;;/h1-9,11-12,14-17,28H,10,13,18-24H2;2*1H

Related Products

Other Form Products of GBR 12935 (dihydrochloride)

Name CAS Formula Suppliers
GBR 12935 76778-22-8 C28H34N2O 11

Recommended Products in Same Target

Name CAS Formula Suppliers
GBR 12935 76778-22-8 C28H34N2O 11
Vanoxerine 67469-69-6 C28H32F2N2O 6
Modafinil 68693-11-8 C15H15NO2S 12
Bupropion (hydrochloride) 31677-93-7 C13H19Cl2NO 12
Amineptine 57574-09-1 C22H27NO2 3
Vanoxerine (dihydrochloride) 67469-78-7 C28H34Cl2F2N2O 15
Diclofensine 67165-56-4 C17H17Cl2NO 8
Fipexide 34161-24-5 C20H21ClN2O4 5
Diclofensine (hydrochloride) 34041-84-4 C17H18Cl3NO 4
Dasotraline (hydrochloride) 675126-08-6 C16H16Cl3N 4
Levophacetoperane (hydrochloride) 23257-56-9 C14H20ClNO2 3
SPD-473 citrate 161190-26-7 C23H31Cl2NO8S 3

Recommended Products in the Same Indication

Name CAS Formula Suppliers

Chemical and Physical Properties

Appearance:White to off-white Solid Melting point:
Boiling point: Flash Point:
Water Solubility: Solubility:
Density: Merck:
BRN: Refractive Index:
Vapour: EINECS:
Optical Rotation: alpha:

Tags: buy GBR 12935 (dihydrochloride) | GBR 12935 (dihydrochloride) IC50 | GBR 12935 (dihydrochloride) price | GBR 12935 (dihydrochloride) cost | GBR 12935 (dihydrochloride) solubility | GBR 12935 (dihydrochloride) purchase | GBR 12935 (dihydrochloride) manufacturer | GBR 12935 (dihydrochloride) research buy | GBR 12935 (dihydrochloride) order | GBR 12935 (dihydrochloride) MSDS | GBR 12935 (dihydrochloride) chemical structure | GBR 12935 (dihydrochloride) Storage condition | GBR 12935 (dihydrochloride) molecular weight | GBR 12935 (dihydrochloride) mw | GBR 12935 (dihydrochloride) datasheet | GBR 12935 (dihydrochloride) supplier | GBR 12935 (dihydrochloride) cell line | GBR 12935 (dihydrochloride) NMR | GBR 12935 (dihydrochloride) MS | GBR 12935 (dihydrochloride) IR | GBR 12935 (dihydrochloride) solubility | GBR 12935 (dihydrochloride) Safe information | GBR 12935 (dihydrochloride) Qc and Spectral Information | GBR 12935 (dihydrochloride) Clinical Information | GBR 12935 (dihydrochloride) Clinical Trial | GBR 12935 (dihydrochloride) Route of Synthesis | GBR 12935 (dihydrochloride) storage condition | GBR 12935 (dihydrochloride) diseases and conditions | GBR 12935 (dihydrochloride) flash point | GBR 12935 (dihydrochloride) boiling point | GBR 12935 (dihydrochloride) melting point | GBR 12935 (dihydrochloride) storage condition | GBR 12935 (dihydrochloride) brand